C7H8Cl2N2O2 — CID 66864935
4,5-dichloro-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 66864935) has the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.06 g/mol. Its IUPAC name is 4,5-dichloro-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 66864935 |
| Molecular Formula | C7H8Cl2N2O2 |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 4,5-dichloro-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | COCCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C7H8Cl2N2O2/c1-13-3-2-11-7(12)6(9)5(8)4-10-11/h4H,2-3H2,1H3 |
| InChIKey | VHRFJGXKUVKVMA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |