C30H27BNO3 — CID 147993953
CID 147993953 (PubChem CID 147993953) has the molecular formula C30H27BNO3 and a molecular weight of 460.36 g/mol.
| Compound Name | CID 147993953 |
|---|---|
| PubChem CID | 147993953 |
| Molecular Formula | C30H27BNO3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cccc2oc3c(-n4c5ccccc5c5ccccc54)cccc3c12 |
| InChI | InChI=1S/C30H27BNO3/c1-29(2,33)30(3,4)35-31-22-14-10-18-26-27(22)21-13-9-17-25(28(21)34-26)32-23-15-7-5-11-19(23)20-12-6-8-16-24(20)32/h5-18,33H,1-4H3 |
| InChIKey | WYGRNYQQOGUEPZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|