C32H31NO — CID 177242457
9-(4,9-ditert-butyldibenzofuran-3-yl)carbazole (PubChem CID 177242457) has the molecular formula C32H31NO and a molecular weight of 445.61 g/mol. Its IUPAC name is 9-(4,9-ditert-butyldibenzofuran-3-yl)carbazole.
| Compound Name | 9-(4,9-ditert-butyldibenzofuran-3-yl)carbazole |
|---|---|
| PubChem CID | 177242457 |
| Molecular Formula | C32H31NO |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 9-(4,9-ditert-butyldibenzofuran-3-yl)carbazole |
| SMILES | CC(C)(C)c1c(-n2c3ccccc3c3ccccc32)ccc2c1oc1cccc(C(C)(C)C)c12 |
| InChI | InChI=1S/C32H31NO/c1-31(2,3)23-14-11-17-27-28(23)22-18-19-26(29(30(22)34-27)32(4,5)6)33-24-15-9-7-12-20(24)21-13-8-10-16-25(21)33/h7-19H,1-6H3 |
| InChIKey | CDXOPRNETGTIIP-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |