C26H29N — CID 143599034
9-(2,5-ditert-butylphenyl)carbazole (PubChem CID 143599034) has the molecular formula C26H29N and a molecular weight of 355.52 g/mol. Its IUPAC name is 9-(2,5-ditert-butylphenyl)carbazole.
| Compound Name | 9-(2,5-ditert-butylphenyl)carbazole |
|---|---|
| PubChem CID | 143599034 |
| Molecular Formula | C26H29N |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 9-(2,5-ditert-butylphenyl)carbazole |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C26H29N/c1-25(2,3)18-15-16-21(26(4,5)6)24(17-18)27-22-13-9-7-11-19(22)20-12-8-10-14-23(20)27/h7-17H,1-6H3 |
| InChIKey | ITZZHHGWJPLJPY-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |