C38H39NS — CID 143599033
9-(2,5-ditert-butylphenyl)carbazole;phenylsulfanylbenzene (PubChem CID 143599033) has the molecular formula C38H39NS and a molecular weight of 541.80 g/mol. Its IUPAC name is 9-(2,5-ditert-butylphenyl)carbazole;phenylsulfanylbenzene.
| Compound Name | 9-(2,5-ditert-butylphenyl)carbazole;phenylsulfanylbenzene |
|---|---|
| PubChem CID | 143599033 |
| Molecular Formula | C38H39NS |
| Molecular Weight | 541.80 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 9-(2,5-ditert-butylphenyl)carbazole;phenylsulfanylbenzene |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(-n2c3ccccc3c3ccccc32)c1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29N.C12H10S/c1-25(2,3)18-15-16-21(26(4,5)6)24(17-18)27-22-13-9-7-11-19(22)20-12-8-10-14-23(20)27;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h7-17H,1-6H3;1-10H |
| InChIKey | MZJBOJQGBSTFPA-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.80 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |