C26H30BNO2 — CID 167442176
(2,5-ditert-butyl-4-carbazol-9-ylphenyl)boronic acid (PubChem CID 167442176) has the molecular formula C26H30BNO2 and a molecular weight of 399.34 g/mol. Its IUPAC name is (2,5-ditert-butyl-4-carbazol-9-ylphenyl)boronic acid.
| Compound Name | (2,5-ditert-butyl-4-carbazol-9-ylphenyl)boronic acid |
|---|---|
| PubChem CID | 167442176 |
| Molecular Formula | C26H30BNO2 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (2,5-ditert-butyl-4-carbazol-9-ylphenyl)boronic acid |
| SMILES | CC(C)(C)c1cc(-n2c3ccccc3c3ccccc32)c(C(C)(C)C)cc1B(O)O |
| InChI | InChI=1S/C26H30BNO2/c1-25(2,3)19-16-24(20(26(4,5)6)15-21(19)27(29)30)28-22-13-9-7-11-17(22)18-12-8-10-14-23(18)28/h7-16,29-30H,1-6H3 |
| InChIKey | VMQPKOLGTXLOCO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|