About 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine
1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 123938498) has the molecular formula C16H17O2P
and a molecular weight of 272.28 g/mol. Its IUPAC name is 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine.
Molecular Properties
| Compound Name | 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine |
| PubChem CID | 123938498 |
| Molecular Formula | C16H17O2P |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | CC(C)(C)c1cccc2o[pH]oc3ccccc3c12 |
| InChI | InChI=1S/C16H17O2P/c1-16(2,3)12-8-6-10-14-15(12)11-7-4-5-9-13(11)17-19-18-14/h4-10,19H,1-3H3 |
| InChIKey | MGOMHHOMXJRTBZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine?
The IUPAC name of 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine (CID 123938498) is 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine.
What is the SMILES notation for 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine?
The canonical SMILES for 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine is CC(C)(C)c1cccc2o[pH]oc3ccccc3c12.
What is the InChIKey of 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine?
The InChIKey is MGOMHHOMXJRTBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17O2P/c1-16(2,3)12-8-6-10-14-15(12)11-7-4-5-9-13(11)17-19-18-14/h4-10,19H,1-3H3.
What are the key properties of 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine?
1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine has a molecular weight of 272.28 g/mol, XLogP of 5.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylbenzo[d][1,3,2]benzodioxaphosphepine is sourced from PubChem (CID 123938498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).