C18H23F — CID 162194038
4,5-ditert-butyl-1-fluoronaphthalene (PubChem CID 162194038) has the molecular formula C18H23F and a molecular weight of 258.38 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-fluoronaphthalene.
| Compound Name | 4,5-ditert-butyl-1-fluoronaphthalene |
|---|---|
| PubChem CID | 162194038 |
| Molecular Formula | C18H23F |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4,5-ditert-butyl-1-fluoronaphthalene |
| SMILES | CC(C)(C)c1cccc2c(F)ccc(C(C)(C)C)c12 |
| InChI | InChI=1S/C18H23F/c1-17(2,3)13-9-7-8-12-15(19)11-10-14(16(12)13)18(4,5)6/h7-11H,1-6H3 |
| InChIKey | DVGCNVKJXKWNEC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |