C16H14F2S — CID 153242561
3-tert-butyl-4,6-difluorodibenzothiophene (PubChem CID 153242561) has the molecular formula C16H14F2S and a molecular weight of 276.35 g/mol. Its IUPAC name is 3-tert-butyl-4,6-difluorodibenzothiophene.
| Compound Name | 3-tert-butyl-4,6-difluorodibenzothiophene |
|---|---|
| PubChem CID | 153242561 |
| Molecular Formula | C16H14F2S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 3-tert-butyl-4,6-difluorodibenzothiophene |
| SMILES | CC(C)(C)c1ccc2c(sc3c(F)cccc32)c1F |
| InChI | InChI=1S/C16H14F2S/c1-16(2,3)11-8-7-10-9-5-4-6-12(17)14(9)19-15(10)13(11)18/h4-8H,1-3H3 |
| InChIKey | WRSOVPKVNCFLMM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |