C8H3ClF2S — CID 130926138
3-chloro-2,7-difluoro-1-benzothiophene (PubChem CID 130926138) has the molecular formula C8H3ClF2S and a molecular weight of 204.63 g/mol. Its IUPAC name is 3-chloro-2,7-difluoro-1-benzothiophene.
| Compound Name | 3-chloro-2,7-difluoro-1-benzothiophene |
|---|---|
| PubChem CID | 130926138 |
| Molecular Formula | C8H3ClF2S |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | 3-chloro-2,7-difluoro-1-benzothiophene |
| SMILES | Fc1sc2c(F)cccc2c1Cl |
| InChI | InChI=1S/C8H3ClF2S/c9-6-4-2-1-3-5(10)7(4)12-8(6)11/h1-3H |
| InChIKey | MKOXWKYLIRBXEM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |