About 7-fluoro-2,3-diiodo-1-benzothiophene
7-fluoro-2,3-diiodo-1-benzothiophene (PubChem CID 130925510) has the molecular formula C8H3FI2S
and a molecular weight of 403.99 g/mol. Its IUPAC name is 7-fluoro-2,3-diiodo-1-benzothiophene.
Molecular Properties
| Compound Name | 7-fluoro-2,3-diiodo-1-benzothiophene |
| PubChem CID | 130925510 |
| Molecular Formula | C8H3FI2S |
| Molecular Weight | 403.99 g/mol |
| Exact Mass | 403.80 |
| IUPAC Name | 7-fluoro-2,3-diiodo-1-benzothiophene |
| SMILES | Fc1cccc2c(I)c(I)sc12 |
| InChI | InChI=1S/C8H3FI2S/c9-5-3-1-2-4-6(10)8(11)12-7(4)5/h1-3H |
| InChIKey | ZNXXOCWBYUPBKN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.99 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-2,3-diiodo-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,3-diiodo-1-benzothiophene?
The IUPAC name of 7-fluoro-2,3-diiodo-1-benzothiophene (CID 130925510) is 7-fluoro-2,3-diiodo-1-benzothiophene.
What is the SMILES notation for 7-fluoro-2,3-diiodo-1-benzothiophene?
The canonical SMILES for 7-fluoro-2,3-diiodo-1-benzothiophene is Fc1cccc2c(I)c(I)sc12.
What is the InChIKey of 7-fluoro-2,3-diiodo-1-benzothiophene?
The InChIKey is ZNXXOCWBYUPBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3FI2S/c9-5-3-1-2-4-6(10)8(11)12-7(4)5/h1-3H.
What are the key properties of 7-fluoro-2,3-diiodo-1-benzothiophene?
7-fluoro-2,3-diiodo-1-benzothiophene has a molecular weight of 403.99 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,3-diiodo-1-benzothiophene is sourced from PubChem (CID 130925510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).