C19H18F2S — CID 146254048
3-(2-cyclopentylethyl)-4,6-difluorodibenzothiophene (PubChem CID 146254048) has the molecular formula C19H18F2S and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-(2-cyclopentylethyl)-4,6-difluorodibenzothiophene.
| Compound Name | 3-(2-cyclopentylethyl)-4,6-difluorodibenzothiophene |
|---|---|
| PubChem CID | 146254048 |
| Molecular Formula | C19H18F2S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-(2-cyclopentylethyl)-4,6-difluorodibenzothiophene |
| SMILES | Fc1cccc2c1sc1c(F)c(CCC3CCCC3)ccc12 |
| InChI | InChI=1S/C19H18F2S/c20-16-7-3-6-14-15-11-10-13(9-8-12-4-1-2-5-12)17(21)19(15)22-18(14)16/h3,6-7,10-12H,1-2,4-5,8-9H2 |
| InChIKey | IIFMPVCMBDNZKC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |