C15H18ClN — CID 106984980
7-chloro-3-(2-cyclopentylethyl)-1H-indole (PubChem CID 106984980) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 7-chloro-3-(2-cyclopentylethyl)-1H-indole.
| Compound Name | 7-chloro-3-(2-cyclopentylethyl)-1H-indole |
|---|---|
| PubChem CID | 106984980 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 7-chloro-3-(2-cyclopentylethyl)-1H-indole |
| SMILES | Clc1cccc2c(CCC3CCCC3)c[nH]c12 |
| InChI | InChI=1S/C15H18ClN/c16-14-7-3-6-13-12(10-17-15(13)14)9-8-11-4-1-2-5-11/h3,6-7,10-11,17H,1-2,4-5,8-9H2 |
| InChIKey | NRQATENGAHKGIV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |