C25H31N5O6 — CID 147998761
cyclopentyl N-[3-[5-carbamoyl-2-[(2,5-dimethylfuran-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]propyl]carbamate (PubChem CID 147998761) has the molecular formula C25H31N5O6 and a molecular weight of 497.55 g/mol. Its IUPAC name is cyclopentyl N-[3-[5-carbamoyl-2-[(2,5-dimethylfuran-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]propyl]carbamate.
| Compound Name | cyclopentyl N-[3-[5-carbamoyl-2-[(2,5-dimethylfuran-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 147998761 |
| Molecular Formula | C25H31N5O6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | cyclopentyl N-[3-[5-carbamoyl-2-[(2,5-dimethylfuran-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]propyl]carbamate |
| SMILES | COc1cc(C(N)=O)cc2nc(NC(=O)c3cc(C)oc3C)n(CCCNC(=O)OC3CCCC3)c12 |
| InChI | InChI=1S/C25H31N5O6/c1-14-11-18(15(2)35-14)23(32)29-24-28-19-12-16(22(26)31)13-20(34-3)21(19)30(24)10-6-9-27-25(33)36-17-7-4-5-8-17/h11-13,17H,4-10H2,1-3H3,(H2,26,31)(H,27,33)(H,28,29,32) |
| InChIKey | IWNCMWLJOHUDNH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|