C27H31N7O5 — CID 175087666
benzyl N-[3-[5-carbamoyl-7-(3-methoxypropoxy)-2-(pyridazin-3-ylamino)benzimidazol-1-yl]propyl]carbamate (PubChem CID 175087666) has the molecular formula C27H31N7O5 and a molecular weight of 533.59 g/mol. Its IUPAC name is benzyl N-[3-[5-carbamoyl-7-(3-methoxypropoxy)-2-(pyridazin-3-ylamino)benzimidazol-1-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-[5-carbamoyl-7-(3-methoxypropoxy)-2-(pyridazin-3-ylamino)benzimidazol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 175087666 |
| Molecular Formula | C27H31N7O5 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | benzyl N-[3-[5-carbamoyl-7-(3-methoxypropoxy)-2-(pyridazin-3-ylamino)benzimidazol-1-yl]propyl]carbamate |
| SMILES | COCCCOc1cc(C(N)=O)cc2nc(Nc3cccnn3)n(CCCNC(=O)OCc3ccccc3)c12 |
| InChI | InChI=1S/C27H31N7O5/c1-37-14-7-15-38-22-17-20(25(28)35)16-21-24(22)34(26(31-21)32-23-10-5-12-30-33-23)13-6-11-29-27(36)39-18-19-8-3-2-4-9-19/h2-5,8-10,12,16-17H,6-7,11,13-15,18H2,1H3,(H2,28,35)(H,29,36)(H,31,32,33) |
| InChIKey | WTFXTBZEHIOVKT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|