C26H31N7O4 — CID 154942080
benzyl N-[3-[5-amino-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]propyl]carbamate (PubChem CID 154942080) has the molecular formula C26H31N7O4 and a molecular weight of 505.58 g/mol. Its IUPAC name is benzyl N-[3-[5-amino-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-[5-amino-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 154942080 |
| Molecular Formula | C26H31N7O4 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | benzyl N-[3-[5-amino-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]propyl]carbamate |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(N)cc(OC)c2n1CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H31N7O4/c1-4-33-21(13-17(2)31-33)24(34)30-25-29-20-14-19(27)15-22(36-3)23(20)32(25)12-8-11-28-26(35)37-16-18-9-6-5-7-10-18/h5-7,9-10,13-15H,4,8,11-12,16,27H2,1-3H3,(H,28,35)(H,29,30,34) |
| InChIKey | DVBWBEXXMKPLCB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|