C29H34N8O4 — CID 146416498
benzyl N-[3-[(11S)-6-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-methyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-11-yl]propyl]carbamate (PubChem CID 146416498) has the molecular formula C29H34N8O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is benzyl N-[3-[(11S)-6-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-methyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-11-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-[(11S)-6-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-methyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-11-yl]propyl]carbamate |
|---|---|
| PubChem CID | 146416498 |
| Molecular Formula | C29H34N8O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | benzyl N-[3-[(11S)-6-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-methyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-11-yl]propyl]carbamate |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)cc3c2n1[C@@H](CCCNC(=O)OCc1ccccc1)CN3C |
| InChI | InChI=1S/C29H34N8O4/c1-4-36-24(13-18(2)34-36)27(39)33-28-32-22-14-20(26(30)38)15-23-25(22)37(28)21(16-35(23)3)11-8-12-31-29(40)41-17-19-9-6-5-7-10-19/h5-7,9-10,13-15,21H,4,8,11-12,16-17H2,1-3H3,(H2,30,38)(H,31,40)(H,32,33,39)/t21-/m0/s1 |
| InChIKey | BWHRDEJSYAFKBU-NRFANRHFSA-N |
| XLogP | 3.61 |
| TPSA | 149.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|