C30H35N7O5 — CID 146416496
methyl (11S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-methyl-11-[3-(phenylmethoxycarbonylamino)propyl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate (PubChem CID 146416496) has the molecular formula C30H35N7O5 and a molecular weight of 573.65 g/mol. Its IUPAC name is methyl (11S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-methyl-11-[3-(phenylmethoxycarbonylamino)propyl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate.
| Compound Name | methyl (11S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-methyl-11-[3-(phenylmethoxycarbonylamino)propyl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate |
|---|---|
| PubChem CID | 146416496 |
| Molecular Formula | C30H35N7O5 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | methyl (11S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-9-methyl-11-[3-(phenylmethoxycarbonylamino)propyl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(=O)OC)cc3c2n1[C@@H](CCCNC(=O)OCc1ccccc1)CN3C |
| InChI | InChI=1S/C30H35N7O5/c1-5-36-25(14-19(2)34-36)27(38)33-29-32-23-15-21(28(39)41-4)16-24-26(23)37(29)22(17-35(24)3)12-9-13-31-30(40)42-18-20-10-7-6-8-11-20/h6-8,10-11,14-16,22H,5,9,12-13,17-18H2,1-4H3,(H,31,40)(H,32,33,38)/t22-/m0/s1 |
| InChIKey | VDDCWLRDRUVMQT-QFIPXVFZSA-N |
| XLogP | 4.30 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|