C9H6F3N3O — CID 1480139
4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 1480139) has the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 1480139 |
| Molecular Formula | C9H6F3N3O |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]ncn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F3N3O/c10-9(11,12)6-2-1-3-7(4-6)15-5-13-14-8(15)16/h1-5H,(H,14,16) |
| InChIKey | VSMRCJLLCFCSNL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |