C17H15N3O4 — CID 14801674
methyl 3-(3-ethyl-2,4-dioxopyrido[2,3-d]pyrimidin-1-yl)benzoate (PubChem CID 14801674) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is methyl 3-(3-ethyl-2,4-dioxopyrido[2,3-d]pyrimidin-1-yl)benzoate.
| Compound Name | methyl 3-(3-ethyl-2,4-dioxopyrido[2,3-d]pyrimidin-1-yl)benzoate |
|---|---|
| PubChem CID | 14801674 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | methyl 3-(3-ethyl-2,4-dioxopyrido[2,3-d]pyrimidin-1-yl)benzoate |
| SMILES | CCn1c(=O)c2cccnc2n(-c2cccc(C(=O)OC)c2)c1=O |
| InChI | InChI=1S/C17H15N3O4/c1-3-19-15(21)13-8-5-9-18-14(13)20(17(19)23)12-7-4-6-11(10-12)16(22)24-2/h4-10H,3H2,1-2H3 |
| InChIKey | RJBYMQOFDFDGAA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |