About 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one
2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one (PubChem CID 1480738) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one.
Analyze 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one?
The IUPAC name of 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one (CID 1480738) is 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one.
What is the SMILES notation for 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one?
The canonical SMILES for 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one is O=c1c2c([nH]n1CCO)CCCC2.
What is the InChIKey of 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one?
The InChIKey is LOCNDGJHKJGPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c12-6-5-11-9(13)7-3-1-2-4-8(7)10-11/h10,12H,1-6H2.
What are the key properties of 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one?
2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one has a molecular weight of 182.22 g/mol, XLogP of 0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyl)-4,5,6,7-tetrahydro-1H-indazol-3-one is sourced from PubChem (CID 1480738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).