C23H18Cl2O2 — CID 14811251
13,16-dichloro-3,6-dimethoxy-1-methylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15(20),16,18-nonaene (PubChem CID 14811251) has the molecular formula C23H18Cl2O2 and a molecular weight of 397.30 g/mol. Its IUPAC name is 13,16-dichloro-3,6-dimethoxy-1-methylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15(20),16,18-nonaene.
| Compound Name | 13,16-dichloro-3,6-dimethoxy-1-methylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 14811251 |
| Molecular Formula | C23H18Cl2O2 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 13,16-dichloro-3,6-dimethoxy-1-methylpentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15(20),16,18-nonaene |
| SMILES | COc1ccc(OC)c2c1C1c3cccc(Cl)c3C2(C)c2c(Cl)cccc21 |
| InChI | InChI=1S/C23H18Cl2O2/c1-23-20-12(6-4-8-14(20)24)18(13-7-5-9-15(25)21(13)23)19-16(26-2)10-11-17(27-3)22(19)23/h4-11,18H,1-3H3 |
| InChIKey | YNCNFTZABDTHQQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |