C26H24O2 — CID 15148301
1-[(E)-but-2-en-2-yl]-3,6-dimethoxypentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene (PubChem CID 15148301) has the molecular formula C26H24O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-3,6-dimethoxypentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene.
| Compound Name | 1-[(E)-but-2-en-2-yl]-3,6-dimethoxypentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 15148301 |
| Molecular Formula | C26H24O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-3,6-dimethoxypentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
| SMILES | C/C=C(\C)C12c3ccccc3C(c3ccccc31)c1c(OC)ccc(OC)c12 |
| InChI | InChI=1S/C26H24O2/c1-5-16(2)26-19-12-8-6-10-17(19)23(18-11-7-9-13-20(18)26)24-21(27-3)14-15-22(28-4)25(24)26/h5-15,23H,1-4H3/b16-5+ |
| InChIKey | XXFMQDODBZJWHJ-FZSIALSZSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|