C8H9N3 — CID 14813792
imidazo[1,2-a]pyridin-6-ylmethanamine (PubChem CID 14813792) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-6-ylmethanamine.
| Compound Name | imidazo[1,2-a]pyridin-6-ylmethanamine |
|---|---|
| PubChem CID | 14813792 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | imidazo[1,2-a]pyridin-6-ylmethanamine |
| SMILES | NCc1ccc2nccn2c1 |
| InChI | InChI=1S/C8H9N3/c9-5-7-1-2-8-10-3-4-11(8)6-7/h1-4,6H,5,9H2 |
| InChIKey | YGXHRFPVDFQLNF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |