C19H22ClN3O3S — CID 1481466
1-benzyl-N'-(4-chlorophenyl)sulfonylpiperidine-4-carbohydrazide (PubChem CID 1481466) has the molecular formula C19H22ClN3O3S and a molecular weight of 407.92 g/mol. Its IUPAC name is 1-benzyl-N'-(4-chlorophenyl)sulfonylpiperidine-4-carbohydrazide.
| Compound Name | 1-benzyl-N'-(4-chlorophenyl)sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 1481466 |
| Molecular Formula | C19H22ClN3O3S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-benzyl-N'-(4-chlorophenyl)sulfonylpiperidine-4-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(Cl)cc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22ClN3O3S/c20-17-6-8-18(9-7-17)27(25,26)22-21-19(24)16-10-12-23(13-11-16)14-15-4-2-1-3-5-15/h1-9,16,22H,10-14H2,(H,21,24) |
| InChIKey | YUXQEHZRQQXVJP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|