C18H16N2O2 — CID 1481697
3-(1,3-benzodioxol-5-yl)-1-[(2-methylphenyl)methyl]pyrazole (PubChem CID 1481697) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[(2-methylphenyl)methyl]pyrazole.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[(2-methylphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 1481697 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[(2-methylphenyl)methyl]pyrazole |
| SMILES | Cc1ccccc1Cn1ccc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C18H16N2O2/c1-13-4-2-3-5-15(13)11-20-9-8-16(19-20)14-6-7-17-18(10-14)22-12-21-17/h2-10H,11-12H2,1H3 |
| InChIKey | UUVULZXBTFNMMT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |