C17H12Cl2N2O2 — CID 1481709
3-(1,3-benzodioxol-5-yl)-1-[(3,4-dichlorophenyl)methyl]pyrazole (PubChem CID 1481709) has the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.20 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[(3,4-dichlorophenyl)methyl]pyrazole.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[(3,4-dichlorophenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 1481709 |
| Molecular Formula | C17H12Cl2N2O2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[(3,4-dichlorophenyl)methyl]pyrazole |
| SMILES | Clc1ccc(Cn2ccc(-c3ccc4c(c3)OCO4)n2)cc1Cl |
| InChI | InChI=1S/C17H12Cl2N2O2/c18-13-3-1-11(7-14(13)19)9-21-6-5-15(20-21)12-2-4-16-17(8-12)23-10-22-16/h1-8H,9-10H2 |
| InChIKey | UIVOXDBIIMJWAW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |