C15H10Cl2N4O2 — CID 2901493
5-(1,3-benzodioxol-5-yl)-2-[(3,4-dichlorophenyl)methyl]tetrazole (PubChem CID 2901493) has the molecular formula C15H10Cl2N4O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-2-[(3,4-dichlorophenyl)methyl]tetrazole.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-2-[(3,4-dichlorophenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 2901493 |
| Molecular Formula | C15H10Cl2N4O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-2-[(3,4-dichlorophenyl)methyl]tetrazole |
| SMILES | Clc1ccc(Cn2nnc(-c3ccc4c(c3)OCO4)n2)cc1Cl |
| InChI | InChI=1S/C15H10Cl2N4O2/c16-11-3-1-9(5-12(11)17)7-21-19-15(18-20-21)10-2-4-13-14(6-10)23-8-22-13/h1-6H,7-8H2 |
| InChIKey | LNBRXFOANHATAA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |