C15H12Cl2N4 — CID 7465665
2-[(3,4-dichlorophenyl)methyl]-5-(4-methylphenyl)tetrazole (PubChem CID 7465665) has the molecular formula C15H12Cl2N4 and a molecular weight of 319.20 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl]-5-(4-methylphenyl)tetrazole.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl]-5-(4-methylphenyl)tetrazole |
|---|---|
| PubChem CID | 7465665 |
| Molecular Formula | C15H12Cl2N4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl]-5-(4-methylphenyl)tetrazole |
| SMILES | Cc1ccc(-c2nnn(Cc3ccc(Cl)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C15H12Cl2N4/c1-10-2-5-12(6-3-10)15-18-20-21(19-15)9-11-4-7-13(16)14(17)8-11/h2-8H,9H2,1H3 |
| InChIKey | OWLZLKRKCPYVJD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |