C13H8ClN3O2 — CID 15749997
2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-b]pyridazine (PubChem CID 15749997) has the molecular formula C13H8ClN3O2 and a molecular weight of 273.68 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-b]pyridazine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 15749997 |
| Molecular Formula | C13H8ClN3O2 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-b]pyridazine |
| SMILES | Clc1ccc2nc(-c3ccc4c(c3)OCO4)cn2n1 |
| InChI | InChI=1S/C13H8ClN3O2/c14-12-3-4-13-15-9(6-17(13)16-12)8-1-2-10-11(5-8)19-7-18-10/h1-6H,7H2 |
| InChIKey | ZNPCQZYSKNBMDT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |