C24H22N4O3 — CID 87534362
N-[6-(1,3-benzodioxol-5-yl)imidazo[1,2-b]pyridazin-2-yl]-N-(4-tert-butylphenyl)formamide (PubChem CID 87534362) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[6-(1,3-benzodioxol-5-yl)imidazo[1,2-b]pyridazin-2-yl]-N-(4-tert-butylphenyl)formamide.
| Compound Name | N-[6-(1,3-benzodioxol-5-yl)imidazo[1,2-b]pyridazin-2-yl]-N-(4-tert-butylphenyl)formamide |
|---|---|
| PubChem CID | 87534362 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[6-(1,3-benzodioxol-5-yl)imidazo[1,2-b]pyridazin-2-yl]-N-(4-tert-butylphenyl)formamide |
| SMILES | CC(C)(C)c1ccc(N(C=O)c2cn3nc(-c4ccc5c(c4)OCO5)ccc3n2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-24(2,3)17-5-7-18(8-6-17)27(14-29)23-13-28-22(25-23)11-9-19(26-28)16-4-10-20-21(12-16)31-15-30-20/h4-14H,15H2,1-3H3 |
| InChIKey | NYBCNLYPZWGCSG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|