C16H15N3O4 — CID 11771382
2-(1,3-benzodioxol-5-yl)-6-(2-methoxyethoxy)imidazo[1,2-b]pyridazine (PubChem CID 11771382) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-(2-methoxyethoxy)imidazo[1,2-b]pyridazine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-(2-methoxyethoxy)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 11771382 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-(2-methoxyethoxy)imidazo[1,2-b]pyridazine |
| SMILES | COCCOc1ccc2nc(-c3ccc4c(c3)OCO4)cn2n1 |
| InChI | InChI=1S/C16H15N3O4/c1-20-6-7-21-16-5-4-15-17-12(9-19(15)18-16)11-2-3-13-14(8-11)23-10-22-13/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | JLNSQOKDKQYIJI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|