C18H16BrN3O6S — CID 42730159
5-(1,3-benzodioxol-5-yl)-1-(4-bromophenyl)sulfonyl-3-(2-methoxyethoxy)-1,2,4-triazole (PubChem CID 42730159) has the molecular formula C18H16BrN3O6S and a molecular weight of 482.31 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-1-(4-bromophenyl)sulfonyl-3-(2-methoxyethoxy)-1,2,4-triazole.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-1-(4-bromophenyl)sulfonyl-3-(2-methoxyethoxy)-1,2,4-triazole |
|---|---|
| PubChem CID | 42730159 |
| Molecular Formula | C18H16BrN3O6S |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-1-(4-bromophenyl)sulfonyl-3-(2-methoxyethoxy)-1,2,4-triazole |
| SMILES | COCCOc1nc(-c2ccc3c(c2)OCO3)n(S(=O)(=O)c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C18H16BrN3O6S/c1-25-8-9-26-18-20-17(12-2-7-15-16(10-12)28-11-27-15)22(21-18)29(23,24)14-5-3-13(19)4-6-14/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | DRQZWHDLMLYJLI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|