C11H7N3O2S — CID 107646923
6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 107646923) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 107646923 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | c1nn2cc(-c3ccc4c(c3)OCO4)nc2s1 |
| InChI | InChI=1S/C11H7N3O2S/c1-2-9-10(16-6-15-9)3-7(1)8-4-14-11(13-8)17-5-12-14/h1-5H,6H2 |
| InChIKey | XBQUXKSOUBUFIN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |