About 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole
6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 107646816) has the molecular formula C8H5N3S2
and a molecular weight of 207.28 g/mol. Its IUPAC name is 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 107646816 |
| Molecular Formula | C8H5N3S2 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | c1cc(-c2cn3ncsc3n2)cs1 |
| InChI | InChI=1S/C8H5N3S2/c1-2-12-4-6(1)7-3-11-8(10-7)13-5-9-11/h1-5H |
| InChIKey | ADJPHAKVSLNLFM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole (CID 107646816) is 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole is c1cc(-c2cn3ncsc3n2)cs1.
What is the InChIKey of 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is ADJPHAKVSLNLFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3S2/c1-2-12-4-6(1)7-3-11-8(10-7)13-5-9-11/h1-5H.
What are the key properties of 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole?
6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 207.28 g/mol, XLogP of 2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 107646816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).