C8H5N3S2 — CID 107646816
6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 107646816) has the molecular formula C8H5N3S2 and a molecular weight of 207.28 g/mol. Its IUPAC name is 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 107646816 |
| Molecular Formula | C8H5N3S2 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | 6-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | c1cc(-c2cn3ncsc3n2)cs1 |
| InChI | InChI=1S/C8H5N3S2/c1-2-12-4-6(1)7-3-11-8(10-7)13-5-9-11/h1-5H |
| InChIKey | ADJPHAKVSLNLFM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |