C12H11N3OS — CID 7539845
6-(4-ethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 7539845) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-(4-ethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 7539845 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 6-(4-ethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCOc1ccc(-c2cn3ncsc3n2)cc1 |
| InChI | InChI=1S/C12H11N3OS/c1-2-16-10-5-3-9(4-6-10)11-7-15-12(14-11)17-8-13-15/h3-8H,2H2,1H3 |
| InChIKey | XWLQYXJTDQDLAQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |