C25H31N3OS — CID 14819327
4-[4-[4-[4-(2-methoxyphenyl)piperidin-1-yl]butyl]phenyl]-1,3-thiazol-2-amine (PubChem CID 14819327) has the molecular formula C25H31N3OS and a molecular weight of 421.61 g/mol. Its IUPAC name is 4-[4-[4-[4-(2-methoxyphenyl)piperidin-1-yl]butyl]phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[4-[4-[4-(2-methoxyphenyl)piperidin-1-yl]butyl]phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 14819327 |
| Molecular Formula | C25H31N3OS |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 4-[4-[4-[4-(2-methoxyphenyl)piperidin-1-yl]butyl]phenyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccccc1C1CCN(CCCCc2ccc(-c3csc(N)n3)cc2)CC1 |
| InChI | InChI=1S/C25H31N3OS/c1-29-24-8-3-2-7-22(24)20-13-16-28(17-14-20)15-5-4-6-19-9-11-21(12-10-19)23-18-30-25(26)27-23/h2-3,7-12,18,20H,4-6,13-17H2,1H3,(H2,26,27) |
| InChIKey | DJFOXXDAOMFPBT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|