C26H29NO4 — CID 14824488
ethyl 2-(dibenzylamino)-3-hydroxy-3-(4-methoxyphenyl)propanoate (PubChem CID 14824488) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is ethyl 2-(dibenzylamino)-3-hydroxy-3-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl 2-(dibenzylamino)-3-hydroxy-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 14824488 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | ethyl 2-(dibenzylamino)-3-hydroxy-3-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(C(O)c1ccc(OC)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO4/c1-3-31-26(29)24(25(28)22-14-16-23(30-2)17-15-22)27(18-20-10-6-4-7-11-20)19-21-12-8-5-9-13-21/h4-17,24-25,28H,3,18-19H2,1-2H3 |
| InChIKey | IZLWYYBYILGFHV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |