C9H7NO3 — CID 14829411
4-phenyl-1,3-oxazolidine-2,5-dione (PubChem CID 14829411) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-phenyl-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-phenyl-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 14829411 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 4-phenyl-1,3-oxazolidine-2,5-dione |
| SMILES | O=C1NC(c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C9H7NO3/c11-8-7(10-9(12)13-8)6-4-2-1-3-5-6/h1-5,7H,(H,10,12) |
| InChIKey | ZSEHBLBYCASPDO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|