About 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide
3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide (PubChem CID 1483049) has the molecular formula C16H12ClNO4
and a molecular weight of 317.73 g/mol. Its IUPAC name is 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide |
| PubChem CID | 1483049 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide |
| SMILES | O=C(Nc1cc2c(oc1=O)CCCC2=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H12ClNO4/c17-10-4-1-3-9(7-10)15(20)18-12-8-11-13(19)5-2-6-14(11)22-16(12)21/h1,3-4,7-8H,2,5-6H2,(H,18,20) |
| InChIKey | ACFYFZIDBMZTRV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide?
The IUPAC name of 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide (CID 1483049) is 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide.
What is the SMILES notation for 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide?
The canonical SMILES for 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide is O=C(Nc1cc2c(oc1=O)CCCC2=O)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide?
The InChIKey is ACFYFZIDBMZTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO4/c17-10-4-1-3-9(7-10)15(20)18-12-8-11-13(19)5-2-6-14(11)22-16(12)21/h1,3-4,7-8H,2,5-6H2,(H,18,20).
What are the key properties of 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide?
3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide has a molecular weight of 317.73 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)benzamide is sourced from PubChem (CID 1483049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).