C21H16ClNO5 — CID 1483053
Ethyl 3-((3-chlorobenzoyl)amino)-2-oxo-6-phenyl-2H-pyran-5-carboxylate (PubChem CID 1483053) has the molecular formula C21H16ClNO5 and a molecular weight of 397.80 g/mol. Its IUPAC name is ethyl 5-[(3-chlorobenzoyl)amino]-6-oxo-2-phenylpyran-3-carboxylate.
| Compound Name | Ethyl 3-((3-chlorobenzoyl)amino)-2-oxo-6-phenyl-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 1483053 |
| Molecular Formula | C21H16ClNO5 |
| Molecular Weight | 397.80 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | ethyl 5-[(3-chlorobenzoyl)amino]-6-oxo-2-phenylpyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(OC(=O)C(=C1)NC(=O)C2=CC(=CC=C2)Cl)C3=CC=CC=C3 |
| InChI | InChI=1S/C21H16ClNO5/c1-2-27-20(25)16-12-17(23-19(24)14-9-6-10-15(22)11-14)21(26)28-18(16)13-7-4-3-5-8-13/h3-12H,2H2,1H3,(H,23,24) |
| InChIKey | VFGKFMLJZQKLSA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | 693 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |