About (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate
(2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate (PubChem CID 2953495) has the molecular formula C18H17ClN2O4
and a molecular weight of 360.80 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate |
| PubChem CID | 2953495 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccccc1)NCC(=O)OCc1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN2O4/c19-15-9-5-4-8-14(15)12-25-17(23)11-20-16(22)10-21-18(24)13-6-2-1-3-7-13/h1-9H,10-12H2,(H,20,22)(H,21,24) |
| InChIKey | DRNWVQXKIKZDLD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate?
The IUPAC name of (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate (CID 2953495) is (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate.
What is the SMILES notation for (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate?
The canonical SMILES for (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate is O=C(CNC(=O)c1ccccc1)NCC(=O)OCc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate?
The InChIKey is DRNWVQXKIKZDLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2O4/c19-15-9-5-4-8-14(15)12-25-17(23)11-20-16(22)10-21-18(24)13-6-2-1-3-7-13/h1-9H,10-12H2,(H,20,22)(H,21,24).
What are the key properties of (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate?
(2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate has a molecular weight of 360.80 g/mol, XLogP of 1.93, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate is sourced from PubChem (CID 2953495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).