C10H14O — CID 14830960
3a,6-dimethyl-4,6a-dihydro-1H-pentalen-1-ol (PubChem CID 14830960) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 3a,6-dimethyl-4,6a-dihydro-1H-pentalen-1-ol.
| Compound Name | 3a,6-dimethyl-4,6a-dihydro-1H-pentalen-1-ol |
|---|---|
| PubChem CID | 14830960 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3a,6-dimethyl-4,6a-dihydro-1H-pentalen-1-ol |
| SMILES | CC1=CCC2(C)C=CC(O)C12 |
| InChI | InChI=1S/C10H14O/c1-7-3-5-10(2)6-4-8(11)9(7)10/h3-4,6,8-9,11H,5H2,1-2H3 |
| InChIKey | USNDQKRRJNXCJN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|