C21H29N — CID 14831238
N-methyl-5-phenyl-N-(1-phenylpropan-2-yl)pentan-1-amine (PubChem CID 14831238) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is N-methyl-5-phenyl-N-(1-phenylpropan-2-yl)pentan-1-amine.
| Compound Name | N-methyl-5-phenyl-N-(1-phenylpropan-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 14831238 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-methyl-5-phenyl-N-(1-phenylpropan-2-yl)pentan-1-amine |
| SMILES | CC(Cc1ccccc1)N(C)CCCCCc1ccccc1 |
| InChI | InChI=1S/C21H29N/c1-19(18-21-15-8-4-9-16-21)22(2)17-11-5-10-14-20-12-6-3-7-13-20/h3-4,6-9,12-13,15-16,19H,5,10-11,14,17-18H2,1-2H3 |
| InChIKey | NXFNRAVCNJHYJE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|