C14H10O — CID 148324
1a,9c-Dihydrophenanthro(3,4-b)oxirene (PubChem CID 148324) has the molecular formula C14H10O and a molecular weight of 194.23 g/mol. Its IUPAC name is 14-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene.
| Compound Name | 1a,9c-Dihydrophenanthro(3,4-b)oxirene |
|---|---|
| PubChem CID | 148324 |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 14-oxatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4C(O4)C=C3 |
| InChI | InChI=1S/C14H10O/c1-2-4-11-9(3-1)5-6-10-7-8-12-14(15-12)13(10)11/h1-8,12,14H |
| InChIKey | SHJAOFFXDWCMOC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | 296 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|