C9H18N2 — CID 14836605
2,2-dimethyl-N-[(3R)-pyrrolidin-3-yl]propan-1-imine (PubChem CID 14836605) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(3R)-pyrrolidin-3-yl]propan-1-imine.
| Compound Name | 2,2-dimethyl-N-[(3R)-pyrrolidin-3-yl]propan-1-imine |
|---|---|
| PubChem CID | 14836605 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2,2-dimethyl-N-[(3R)-pyrrolidin-3-yl]propan-1-imine |
| SMILES | CC(C)(C)/C=N/[C@@H]1CCNC1 |
| InChI | InChI=1S/C9H18N2/c1-9(2,3)7-11-8-4-5-10-6-8/h7-8,10H,4-6H2,1-3H3/b11-7+/t8-/m1/s1 |
| InChIKey | MIMQEVRXLNVDIH-XAPLUZPNSA-N |
| XLogP | 1.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|