C16H19N5O2 — CID 14843009
1,3-dipropyl-8-pyridin-3-yl-7H-purine-2,6-dione (PubChem CID 14843009) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1,3-dipropyl-8-pyridin-3-yl-7H-purine-2,6-dione.
| Compound Name | 1,3-dipropyl-8-pyridin-3-yl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 14843009 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1,3-dipropyl-8-pyridin-3-yl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cccnc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C16H19N5O2/c1-3-8-20-14-12(15(22)21(9-4-2)16(20)23)18-13(19-14)11-6-5-7-17-10-11/h5-7,10H,3-4,8-9H2,1-2H3,(H,18,19) |
| InChIKey | OLTGZKBENYFNAC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |