C8H11FN2O3 — CID 14843055
1-(2-fluoroethoxymethyl)-5-methylpyrimidine-2,4-dione (PubChem CID 14843055) has the molecular formula C8H11FN2O3 and a molecular weight of 202.18 g/mol. Its IUPAC name is 1-(2-fluoroethoxymethyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-(2-fluoroethoxymethyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14843055 |
| Molecular Formula | C8H11FN2O3 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1-(2-fluoroethoxymethyl)-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(COCCF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H11FN2O3/c1-6-4-11(5-14-3-2-9)8(13)10-7(6)12/h4H,2-3,5H2,1H3,(H,10,12,13) |
| InChIKey | GRUHUJLODIINJO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|