C16H19NO4 — CID 14843095
[2-[(4-methoxyphenyl)methyl]-3-oxo-2-azabicyclo[2.2.1]heptan-6-yl] acetate (PubChem CID 14843095) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methyl]-3-oxo-2-azabicyclo[2.2.1]heptan-6-yl] acetate.
| Compound Name | [2-[(4-methoxyphenyl)methyl]-3-oxo-2-azabicyclo[2.2.1]heptan-6-yl] acetate |
|---|---|
| PubChem CID | 14843095 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [2-[(4-methoxyphenyl)methyl]-3-oxo-2-azabicyclo[2.2.1]heptan-6-yl] acetate |
| SMILES | COc1ccc(CN2C(=O)C3CC(OC(C)=O)C2C3)cc1 |
| InChI | InChI=1S/C16H19NO4/c1-10(18)21-15-8-12-7-14(15)17(16(12)19)9-11-3-5-13(20-2)6-4-11/h3-6,12,14-15H,7-9H2,1-2H3 |
| InChIKey | JECDCCUNEWJERR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |