C23H21NO7 — CID 14847271
11,15,23-trimethoxy-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(13),2,4(8),9,11,14,16,21-octaene (PubChem CID 14847271) has the molecular formula C23H21NO7 and a molecular weight of 423.42 g/mol. Its IUPAC name is 11,15,23-trimethoxy-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(13),2,4(8),9,11,14,16,21-octaene.
| Compound Name | 11,15,23-trimethoxy-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(13),2,4(8),9,11,14,16,21-octaene |
|---|---|
| PubChem CID | 14847271 |
| Molecular Formula | C23H21NO7 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 11,15,23-trimethoxy-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(13),2,4(8),9,11,14,16,21-octaene |
| SMILES | COc1cc2c(c3c1-c1cc(OC)c4cc5c(cc4c1N(C)C3OC)OCO5)OCO2 |
| InChI | InChI=1S/C23H21NO7/c1-24-21-12-6-16-15(28-9-29-16)5-11(12)14(25-2)7-13(21)19-17(26-3)8-18-22(31-10-30-18)20(19)23(24)27-4/h5-8,23H,9-10H2,1-4H3 |
| InChIKey | NKKLZCROLFBWRI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|